C6H11NO2S — CID 13419864
4-methylsulfanylpyrrolidine-2-carboxylic acid (PubChem CID 13419864) has the molecular formula C6H11NO2S and a molecular weight of 161.23 g/mol. Its IUPAC name is 4-methylsulfanylpyrrolidine-2-carboxylic acid.
| Compound Name | 4-methylsulfanylpyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 13419864 |
| Molecular Formula | C6H11NO2S |
| Molecular Weight | 161.23 g/mol |
| Exact Mass | 161.05 |
| IUPAC Name | 4-methylsulfanylpyrrolidine-2-carboxylic acid |
| SMILES | CSC1CNC(C(=O)O)C1 |
| InChI | InChI=1S/C6H11NO2S/c1-10-4-2-5(6(8)9)7-3-4/h4-5,7H,2-3H2,1H3,(H,8,9) |
| InChIKey | KZLPQCNSZCKHAI-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.23 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |