C11H13NO2S — CID 71751645
(2S,4S)-4-(2,3,4,5,6-pentadeuteriophenyl)sulfanylpyrrolidine-2-carboxylic acid (PubChem CID 71751645) has the molecular formula C11H13NO2S and a molecular weight of 228.33 g/mol. Its IUPAC name is (2S,4S)-4-(2,3,4,5,6-pentadeuteriophenyl)sulfanylpyrrolidine-2-carboxylic acid.
| Compound Name | (2S,4S)-4-(2,3,4,5,6-pentadeuteriophenyl)sulfanylpyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 71751645 |
| Molecular Formula | C11H13NO2S |
| Molecular Weight | 228.33 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | (2S,4S)-4-(2,3,4,5,6-pentadeuteriophenyl)sulfanylpyrrolidine-2-carboxylic acid |
| SMILES | [2H]c1c([2H])c([2H])c(S[C@@H]2CN[C@H](C(=O)O)C2)c([2H])c1[2H] |
| InChI | InChI=1S/C11H13NO2S/c13-11(14)10-6-9(7-12-10)15-8-4-2-1-3-5-8/h1-5,9-10,12H,6-7H2,(H,13,14)/t9-,10-/m0/s1/i1D,2D,3D,4D,5D |
| InChIKey | PCIUUPKYZVILEM-PLGYOIJJSA-N |
| XLogP | 1.59 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.33 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |