C21H27NO2 — CID 134203331
ethyl 2-[4-(6-methylquinolin-4-yl)cyclohexyl]propanoate (PubChem CID 134203331) has the molecular formula C21H27NO2 and a molecular weight of 325.45 g/mol. Its IUPAC name is ethyl 2-[4-(6-methylquinolin-4-yl)cyclohexyl]propanoate.
| Compound Name | ethyl 2-[4-(6-methylquinolin-4-yl)cyclohexyl]propanoate |
|---|---|
| PubChem CID | 134203331 |
| Molecular Formula | C21H27NO2 |
| Molecular Weight | 325.45 g/mol |
| Exact Mass | 325.20 |
| IUPAC Name | ethyl 2-[4-(6-methylquinolin-4-yl)cyclohexyl]propanoate |
| SMILES | CCOC(=O)C(C)C1CCC(c2ccnc3ccc(C)cc23)CC1 |
| InChI | InChI=1S/C21H27NO2/c1-4-24-21(23)15(3)16-6-8-17(9-7-16)18-11-12-22-20-10-5-14(2)13-19(18)20/h5,10-13,15-17H,4,6-9H2,1-3H3 |
| InChIKey | GTESOLCNZOPERD-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.45 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |