C18H24F3NO2S — CID 134204247
N-(3-ethyl-3-bicyclo[3.3.1]nonanyl)-4-(trifluoromethyl)benzenesulfonamide (PubChem CID 134204247) has the molecular formula C18H24F3NO2S and a molecular weight of 375.46 g/mol. Its IUPAC name is N-(3-ethyl-3-bicyclo[3.3.1]nonanyl)-4-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-(3-ethyl-3-bicyclo[3.3.1]nonanyl)-4-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 134204247 |
| Molecular Formula | C18H24F3NO2S |
| Molecular Weight | 375.46 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | N-(3-ethyl-3-bicyclo[3.3.1]nonanyl)-4-(trifluoromethyl)benzenesulfonamide |
| SMILES | CCC1(NS(=O)(=O)c2ccc(C(F)(F)F)cc2)CC2CCCC(C2)C1 |
| InChI | InChI=1S/C18H24F3NO2S/c1-2-17(11-13-4-3-5-14(10-13)12-17)22-25(23,24)16-8-6-15(7-9-16)18(19,20)21/h6-9,13-14,22H,2-5,10-12H2,1H3 |
| InChIKey | PUXKRBMSOBHAHO-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.46 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |