C36H32OS2 — CID 134205472
2-[2-methylsulfinyl-5-(4-pentylphenyl)phenyl]-6-phenylbenzo[f][1]benzothiole (PubChem CID 134205472) has the molecular formula C36H32OS2 and a molecular weight of 544.79 g/mol. Its IUPAC name is 2-[2-methylsulfinyl-5-(4-pentylphenyl)phenyl]-6-phenylbenzo[f][1]benzothiole.
| Compound Name | 2-[2-methylsulfinyl-5-(4-pentylphenyl)phenyl]-6-phenylbenzo[f][1]benzothiole |
|---|---|
| PubChem CID | 134205472 |
| Molecular Formula | C36H32OS2 |
| Molecular Weight | 544.79 g/mol |
| Exact Mass | 544.19 |
| IUPAC Name | 2-[2-methylsulfinyl-5-(4-pentylphenyl)phenyl]-6-phenylbenzo[f][1]benzothiole |
| SMILES | CCCCCc1ccc(-c2ccc(S(C)=O)c(-c3cc4cc5cc(-c6ccccc6)ccc5cc4s3)c2)cc1 |
| InChI | InChI=1S/C36H32OS2/c1-3-4-6-9-25-12-14-27(15-13-25)29-18-19-36(39(2)37)33(22-29)35-24-32-21-31-20-28(26-10-7-5-8-11-26)16-17-30(31)23-34(32)38-35/h5,7-8,10-24H,3-4,6,9H2,1-2H3 |
| InChIKey | PENZMXPSUMUOEQ-UHFFFAOYSA-N |
| XLogP | 10.53 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.79 |
| LogP ≤ 5 | 10.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|