C11H18O2 — CID 134205666
[(1E,3E)-hepta-1,3-dienyl] 2-methylpropanoate (PubChem CID 134205666) has the molecular formula C11H18O2 and a molecular weight of 182.26 g/mol. Its IUPAC name is [(1E,3E)-hepta-1,3-dienyl] 2-methylpropanoate.
| Compound Name | [(1E,3E)-hepta-1,3-dienyl] 2-methylpropanoate |
|---|---|
| PubChem CID | 134205666 |
| Molecular Formula | C11H18O2 |
| Molecular Weight | 182.26 g/mol |
| Exact Mass | 182.13 |
| IUPAC Name | [(1E,3E)-hepta-1,3-dienyl] 2-methylpropanoate |
| SMILES | CCC/C=C/C=C/OC(=O)C(C)C |
| InChI | InChI=1S/C11H18O2/c1-4-5-6-7-8-9-13-11(12)10(2)3/h6-10H,4-5H2,1-3H3/b7-6+,9-8+ |
| InChIKey | AUUSTLDQRREWEJ-BLHCBFLLSA-N |
| XLogP | 3.06 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.26 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|