C16H19N5O4 — CID 134209989
2-[[2-[(4-cyanoanilino)carbamoyl]pyrrolidine-1-carbonyl]amino]propanoic acid (PubChem CID 134209989) has the molecular formula C16H19N5O4 and a molecular weight of 345.36 g/mol. Its IUPAC name is 2-[[2-[(4-cyanoanilino)carbamoyl]pyrrolidine-1-carbonyl]amino]propanoic acid.
| Compound Name | 2-[[2-[(4-cyanoanilino)carbamoyl]pyrrolidine-1-carbonyl]amino]propanoic acid |
|---|---|
| PubChem CID | 134209989 |
| Molecular Formula | C16H19N5O4 |
| Molecular Weight | 345.36 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | 2-[[2-[(4-cyanoanilino)carbamoyl]pyrrolidine-1-carbonyl]amino]propanoic acid |
| SMILES | CC(NC(=O)N1CCCC1C(=O)NNc1ccc(C#N)cc1)C(=O)O |
| InChI | InChI=1S/C16H19N5O4/c1-10(15(23)24)18-16(25)21-8-2-3-13(21)14(22)20-19-12-6-4-11(9-17)5-7-12/h4-7,10,13,19H,2-3,8H2,1H3,(H,18,25)(H,20,22)(H,23,24) |
| InChIKey | DDRMOHRAUBUEKQ-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 134.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.36 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|