C18H24FN5O5 — CID 134209963
[4-amino-3-[[2-[(4-fluoroanilino)carbamoyl]pyrrolidine-1-carbonyl]amino]-4-oxobutan-2-yl] acetate (PubChem CID 134209963) has the molecular formula C18H24FN5O5 and a molecular weight of 409.42 g/mol. Its IUPAC name is [4-amino-3-[[2-[(4-fluoroanilino)carbamoyl]pyrrolidine-1-carbonyl]amino]-4-oxobutan-2-yl] acetate.
| Compound Name | [4-amino-3-[[2-[(4-fluoroanilino)carbamoyl]pyrrolidine-1-carbonyl]amino]-4-oxobutan-2-yl] acetate |
|---|---|
| PubChem CID | 134209963 |
| Molecular Formula | C18H24FN5O5 |
| Molecular Weight | 409.42 g/mol |
| Exact Mass | 409.18 |
| IUPAC Name | [4-amino-3-[[2-[(4-fluoroanilino)carbamoyl]pyrrolidine-1-carbonyl]amino]-4-oxobutan-2-yl] acetate |
| SMILES | CC(=O)OC(C)C(NC(=O)N1CCCC1C(=O)NNc1ccc(F)cc1)C(N)=O |
| InChI | InChI=1S/C18H24FN5O5/c1-10(29-11(2)25)15(16(20)26)21-18(28)24-9-3-4-14(24)17(27)23-22-13-7-5-12(19)6-8-13/h5-8,10,14-15,22H,3-4,9H2,1-2H3,(H2,20,26)(H,21,28)(H,23,27) |
| InChIKey | HKAPIFRHICNTNI-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 142.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.42 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|