C13H17FN4O2 — CID 134220723
2-[(4-fluoro-2-methylanilino)carbamoyl]pyrrolidine-1-carboxamide (PubChem CID 134220723) has the molecular formula C13H17FN4O2 and a molecular weight of 280.30 g/mol. Its IUPAC name is 2-[(4-fluoro-2-methylanilino)carbamoyl]pyrrolidine-1-carboxamide.
| Compound Name | 2-[(4-fluoro-2-methylanilino)carbamoyl]pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 134220723 |
| Molecular Formula | C13H17FN4O2 |
| Molecular Weight | 280.30 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | 2-[(4-fluoro-2-methylanilino)carbamoyl]pyrrolidine-1-carboxamide |
| SMILES | Cc1cc(F)ccc1NNC(=O)C1CCCN1C(N)=O |
| InChI | InChI=1S/C13H17FN4O2/c1-8-7-9(14)4-5-10(8)16-17-12(19)11-3-2-6-18(11)13(15)20/h4-5,7,11,16H,2-3,6H2,1H3,(H2,15,20)(H,17,19) |
| InChIKey | OKCPPBCTKGZQGF-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.30 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|