C16H21N3O5 — CID 134209965
methyl 2-[(2-ethoxycarbonylanilino)carbamoyl]pyrrolidine-1-carboxylate (PubChem CID 134209965) has the molecular formula C16H21N3O5 and a molecular weight of 335.36 g/mol. Its IUPAC name is methyl 2-[(2-ethoxycarbonylanilino)carbamoyl]pyrrolidine-1-carboxylate.
| Compound Name | methyl 2-[(2-ethoxycarbonylanilino)carbamoyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 134209965 |
| Molecular Formula | C16H21N3O5 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | methyl 2-[(2-ethoxycarbonylanilino)carbamoyl]pyrrolidine-1-carboxylate |
| SMILES | CCOC(=O)c1ccccc1NNC(=O)C1CCCN1C(=O)OC |
| InChI | InChI=1S/C16H21N3O5/c1-3-24-15(21)11-7-4-5-8-12(11)17-18-14(20)13-9-6-10-19(13)16(22)23-2/h4-5,7-8,13,17H,3,6,9-10H2,1-2H3,(H,18,20) |
| InChIKey | BLWUAGCJJDQOJB-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|