About 3-ethyl-1,8,8-trimethyl-3-azoniabicyclo[3.2.1]octane chloride
3-ethyl-1,8,8-trimethyl-3-azoniabicyclo[3.2.1]octane chloride (PubChem CID 13421) has the molecular formula C12H24ClN
and a molecular weight of 217.78 g/mol. Its IUPAC name is 3-ethyl-1,8,8-trimethyl-3-azoniabicyclo[3.2.1]octane chloride.
Analyze 3-ethyl-1,8,8-trimethyl-3-azoniabicyclo[3.2.1]octane chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-1,8,8-trimethyl-3-azoniabicyclo[3.2.1]octane chloride?
The IUPAC name of 3-ethyl-1,8,8-trimethyl-3-azoniabicyclo[3.2.1]octane chloride (CID 13421) is 3-ethyl-1,8,8-trimethyl-3-azoniabicyclo[3.2.1]octane chloride.
What is the SMILES notation for 3-ethyl-1,8,8-trimethyl-3-azoniabicyclo[3.2.1]octane chloride?
The canonical SMILES for 3-ethyl-1,8,8-trimethyl-3-azoniabicyclo[3.2.1]octane chloride is CC[NH+]1CC2CCC(C)(C1)C2(C)C.[Cl-].
What is the InChIKey of 3-ethyl-1,8,8-trimethyl-3-azoniabicyclo[3.2.1]octane chloride?
The InChIKey is BTQCGGASMLMWSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23N.ClH/c1-5-13-8-10-6-7-12(4,9-13)11(10,2)3;/h10H,5-9H2,1-4H3;1H.
What are the key properties of 3-ethyl-1,8,8-trimethyl-3-azoniabicyclo[3.2.1]octane chloride?
3-ethyl-1,8,8-trimethyl-3-azoniabicyclo[3.2.1]octane chloride has a molecular weight of 217.78 g/mol, XLogP of -1.65, 1 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-1,8,8-trimethyl-3-azoniabicyclo[3.2.1]octane chloride is sourced from PubChem (CID 13421), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).