C13H26N+ — CID 4226769
3-ethyl-1,3,8,8-tetramethyl-3-azoniabicyclo[3.2.1]octane (PubChem CID 4226769) has the molecular formula C13H26N+ and a molecular weight of 196.36 g/mol. Its IUPAC name is 3-ethyl-1,3,8,8-tetramethyl-3-azoniabicyclo[3.2.1]octane.
| Compound Name | 3-ethyl-1,3,8,8-tetramethyl-3-azoniabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 4226769 |
| Molecular Formula | C13H26N+ |
| Molecular Weight | 196.36 g/mol |
| Exact Mass | 196.21 |
| IUPAC Name | 3-ethyl-1,3,8,8-tetramethyl-3-azoniabicyclo[3.2.1]octane |
| SMILES | CC[N+]1(C)CC2CCC(C)(C1)C2(C)C |
| InChI | InChI=1S/C13H26N/c1-6-14(5)9-11-7-8-13(4,10-14)12(11,2)3/h11H,6-10H2,1-5H3/q+1 |
| InChIKey | ZCBWZIDLZUDXMT-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.36 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|