C23H44I2N2 — CID 137321577
1,3,8,8-tetramethyl-3-[(1,3,8,8-tetramethyl-3-azoniabicyclo[3.2.1]octan-3-yl)methyl]-3-azoniabicyclo[3.2.1]octane diiodide (PubChem CID 137321577) has the molecular formula C23H44I2N2 and a molecular weight of 602.43 g/mol. Its IUPAC name is 1,3,8,8-tetramethyl-3-[(1,3,8,8-tetramethyl-3-azoniabicyclo[3.2.1]octan-3-yl)methyl]-3-azoniabicyclo[3.2.1]octane diiodide.
| Compound Name | 1,3,8,8-tetramethyl-3-[(1,3,8,8-tetramethyl-3-azoniabicyclo[3.2.1]octan-3-yl)methyl]-3-azoniabicyclo[3.2.1]octane diiodide |
|---|---|
| PubChem CID | 137321577 |
| Molecular Formula | C23H44I2N2 |
| Molecular Weight | 602.43 g/mol |
| Exact Mass | 602.16 |
| IUPAC Name | 1,3,8,8-tetramethyl-3-[(1,3,8,8-tetramethyl-3-azoniabicyclo[3.2.1]octan-3-yl)methyl]-3-azoniabicyclo[3.2.1]octane diiodide |
| SMILES | CC12CCC(C[N+](C)(C[N+]3(C)CC4CCC(C)(C3)C4(C)C)C1)C2(C)C.[I-].[I-] |
| InChI | InChI=1S/C23H44N2.2HI/c1-20(2)18-9-11-22(20,5)15-24(7,13-18)17-25(8)14-19-10-12-23(6,16-25)21(19,3)4;;/h18-19H,9-17H2,1-8H3;2*1H/q+2;;/p-2 |
| InChIKey | SZSUMIXEHFEKTB-UHFFFAOYSA-L |
| XLogP | -1.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.43 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|