C10H12Cl2N2O — CID 134210113
4,6-dichloro-N-methyl-N-propan-2-ylpyridine-3-carboxamide (PubChem CID 134210113) has the molecular formula C10H12Cl2N2O and a molecular weight of 247.12 g/mol. Its IUPAC name is 4,6-dichloro-N-methyl-N-propan-2-ylpyridine-3-carboxamide.
| Compound Name | 4,6-dichloro-N-methyl-N-propan-2-ylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 134210113 |
| Molecular Formula | C10H12Cl2N2O |
| Molecular Weight | 247.12 g/mol |
| Exact Mass | 246.03 |
| IUPAC Name | 4,6-dichloro-N-methyl-N-propan-2-ylpyridine-3-carboxamide |
| SMILES | CC(C)N(C)C(=O)c1cnc(Cl)cc1Cl |
| InChI | InChI=1S/C10H12Cl2N2O/c1-6(2)14(3)10(15)7-5-13-9(12)4-8(7)11/h4-6H,1-3H3 |
| InChIKey | KTEFIXBDWGIJRN-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.12 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|