C19H19F3N6O — CID 134211397
7-(4-methyl-4-oxidopiperazin-4-ium-1-yl)-6-[2-(trifluoromethyl)phenyl]pyrido[2,3-d]pyrimidin-2-amine (PubChem CID 134211397) has the molecular formula C19H19F3N6O and a molecular weight of 404.40 g/mol. Its IUPAC name is 7-(4-methyl-4-oxidopiperazin-4-ium-1-yl)-6-[2-(trifluoromethyl)phenyl]pyrido[2,3-d]pyrimidin-2-amine.
| Compound Name | 7-(4-methyl-4-oxidopiperazin-4-ium-1-yl)-6-[2-(trifluoromethyl)phenyl]pyrido[2,3-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 134211397 |
| Molecular Formula | C19H19F3N6O |
| Molecular Weight | 404.40 g/mol |
| Exact Mass | 404.16 |
| IUPAC Name | 7-(4-methyl-4-oxidopiperazin-4-ium-1-yl)-6-[2-(trifluoromethyl)phenyl]pyrido[2,3-d]pyrimidin-2-amine |
| SMILES | C[N+]1([O-])CCN(c2nc3nc(N)ncc3cc2-c2ccccc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C19H19F3N6O/c1-28(29)8-6-27(7-9-28)17-14(10-12-11-24-18(23)26-16(12)25-17)13-4-2-3-5-15(13)19(20,21)22/h2-5,10-11H,6-9H2,1H3,(H2,23,24,25,26) |
| InChIKey | KKFFYTRHVORBMB-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 90.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.40 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|