C13H16F2N4O3 — CID 134211803
4,4-difluoro-2-[(4-methoxyanilino)carbamoyl]pyrrolidine-1-carboxamide (PubChem CID 134211803) has the molecular formula C13H16F2N4O3 and a molecular weight of 314.29 g/mol. Its IUPAC name is 4,4-difluoro-2-[(4-methoxyanilino)carbamoyl]pyrrolidine-1-carboxamide.
| Compound Name | 4,4-difluoro-2-[(4-methoxyanilino)carbamoyl]pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 134211803 |
| Molecular Formula | C13H16F2N4O3 |
| Molecular Weight | 314.29 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | 4,4-difluoro-2-[(4-methoxyanilino)carbamoyl]pyrrolidine-1-carboxamide |
| SMILES | COc1ccc(NNC(=O)C2CC(F)(F)CN2C(N)=O)cc1 |
| InChI | InChI=1S/C13H16F2N4O3/c1-22-9-4-2-8(3-5-9)17-18-11(20)10-6-13(14,15)7-19(10)12(16)21/h2-5,10,17H,6-7H2,1H3,(H2,16,21)(H,18,20) |
| InChIKey | NXXMOJCXCMUNAR-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.29 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|