C19H35NO — CID 134213203
10-methyl-2-oxa-10-azatricyclo[9.6.2.13,9]icosane (PubChem CID 134213203) has the molecular formula C19H35NO and a molecular weight of 293.50 g/mol. Its IUPAC name is 10-methyl-2-oxa-10-azatricyclo[9.6.2.13,9]icosane.
| Compound Name | 10-methyl-2-oxa-10-azatricyclo[9.6.2.13,9]icosane |
|---|---|
| PubChem CID | 134213203 |
| Molecular Formula | C19H35NO |
| Molecular Weight | 293.50 g/mol |
| Exact Mass | 293.27 |
| IUPAC Name | 10-methyl-2-oxa-10-azatricyclo[9.6.2.13,9]icosane |
| SMILES | CN1C2CCCCCCC(CC2)OC2CCCCCC1C2 |
| InChI | InChI=1S/C19H35NO/c1-20-16-9-5-2-3-7-11-18(14-13-16)21-19-12-8-4-6-10-17(20)15-19/h16-19H,2-15H2,1H3 |
| InChIKey | JCCNHASFZMAVDJ-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.50 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |