C19H21ClN6O2 — CID 134214822
N-[4-(6-amino-2-chloropurin-9-yl)cyclohexyl]-3-methoxybenzamide (PubChem CID 134214822) has the molecular formula C19H21ClN6O2 and a molecular weight of 400.87 g/mol. Its IUPAC name is N-[4-(6-amino-2-chloropurin-9-yl)cyclohexyl]-3-methoxybenzamide.
| Compound Name | N-[4-(6-amino-2-chloropurin-9-yl)cyclohexyl]-3-methoxybenzamide |
|---|---|
| PubChem CID | 134214822 |
| Molecular Formula | C19H21ClN6O2 |
| Molecular Weight | 400.87 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | N-[4-(6-amino-2-chloropurin-9-yl)cyclohexyl]-3-methoxybenzamide |
| SMILES | COc1cccc(C(=O)NC2CCC(n3cnc4c(N)nc(Cl)nc43)CC2)c1 |
| InChI | InChI=1S/C19H21ClN6O2/c1-28-14-4-2-3-11(9-14)18(27)23-12-5-7-13(8-6-12)26-10-22-15-16(21)24-19(20)25-17(15)26/h2-4,9-10,12-13H,5-8H2,1H3,(H,23,27)(H2,21,24,25) |
| InChIKey | VIPDMQKDNFIHOI-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 107.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.87 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |