C21H22F2N6O3 — CID 134216835
N-[8-[3,5-difluoro-4-[[3-(methylaminoperoxy)azetidin-1-yl]methyl]phenyl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]cyclopropanecarboxamide (PubChem CID 134216835) has the molecular formula C21H22F2N6O3 and a molecular weight of 444.44 g/mol. Its IUPAC name is N-[8-[3,5-difluoro-4-[[3-(methylaminoperoxy)azetidin-1-yl]methyl]phenyl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]cyclopropanecarboxamide.
| Compound Name | N-[8-[3,5-difluoro-4-[[3-(methylaminoperoxy)azetidin-1-yl]methyl]phenyl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 134216835 |
| Molecular Formula | C21H22F2N6O3 |
| Molecular Weight | 444.44 g/mol |
| Exact Mass | 444.17 |
| IUPAC Name | N-[8-[3,5-difluoro-4-[[3-(methylaminoperoxy)azetidin-1-yl]methyl]phenyl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]cyclopropanecarboxamide |
| SMILES | CNOOC1CN(Cc2c(F)cc(-c3cccn4nc(NC(=O)C5CC5)nc34)cc2F)C1 |
| InChI | InChI=1S/C21H22F2N6O3/c1-24-32-31-14-9-28(10-14)11-16-17(22)7-13(8-18(16)23)15-3-2-6-29-19(15)25-21(27-29)26-20(30)12-4-5-12/h2-3,6-8,12,14,24H,4-5,9-11H2,1H3,(H,26,27,30) |
| InChIKey | PWZFJKGKDYYJSZ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 93.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.44 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|