C20H24N4O2 — CID 143929581
ethane;N-[8-[(3Z,5E)-5-formylhepta-1,3,5-trien-2-yl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]cyclopropanecarboxamide (PubChem CID 143929581) has the molecular formula C20H24N4O2 and a molecular weight of 352.44 g/mol. Its IUPAC name is ethane;N-[8-[(3Z,5E)-5-formylhepta-1,3,5-trien-2-yl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]cyclopropanecarboxamide.
| Compound Name | ethane;N-[8-[(3Z,5E)-5-formylhepta-1,3,5-trien-2-yl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 143929581 |
| Molecular Formula | C20H24N4O2 |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | ethane;N-[8-[(3Z,5E)-5-formylhepta-1,3,5-trien-2-yl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]cyclopropanecarboxamide |
| SMILES | C=C(/C=C\C(C=O)=C/C)c1cccn2nc(NC(=O)C3CC3)nc12.CC |
| InChI | InChI=1S/C18H18N4O2.C2H6/c1-3-13(11-23)7-6-12(2)15-5-4-10-22-16(15)19-18(21-22)20-17(24)14-8-9-14;1-2/h3-7,10-11,14H,2,8-9H2,1H3,(H,20,21,24);1-2H3/b7-6-,13-3+; |
| InChIKey | DHKPOJNQYZNIEZ-HYVVUOPESA-N |
| XLogP | 3.82 |
| TPSA | 76.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|