C27H29N5O3 — CID 143929645
4-[2-(cyclopropanecarbonylamino)-[1,2,4]triazolo[1,5-a]pyridin-8-yl]-N-(2-phenoxyethyl)benzamide;ethane (PubChem CID 143929645) has the molecular formula C27H29N5O3 and a molecular weight of 471.56 g/mol. Its IUPAC name is 4-[2-(cyclopropanecarbonylamino)-[1,2,4]triazolo[1,5-a]pyridin-8-yl]-N-(2-phenoxyethyl)benzamide;ethane.
| Compound Name | 4-[2-(cyclopropanecarbonylamino)-[1,2,4]triazolo[1,5-a]pyridin-8-yl]-N-(2-phenoxyethyl)benzamide;ethane |
|---|---|
| PubChem CID | 143929645 |
| Molecular Formula | C27H29N5O3 |
| Molecular Weight | 471.56 g/mol |
| Exact Mass | 471.23 |
| IUPAC Name | 4-[2-(cyclopropanecarbonylamino)-[1,2,4]triazolo[1,5-a]pyridin-8-yl]-N-(2-phenoxyethyl)benzamide;ethane |
| SMILES | CC.O=C(NCCOc1ccccc1)c1ccc(-c2cccn3nc(NC(=O)C4CC4)nc23)cc1 |
| InChI | InChI=1S/C25H23N5O3.C2H6/c31-23(26-14-16-33-20-5-2-1-3-6-20)18-10-8-17(9-11-18)21-7-4-15-30-22(21)27-25(29-30)28-24(32)19-12-13-19;1-2/h1-11,15,19H,12-14,16H2,(H,26,31)(H,28,29,32);1-2H3 |
| InChIKey | QGXLHOASXVRUBM-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 97.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.56 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|