C22H19NO3 — CID 141009593
4-(2-formylphenyl)-N-(2-phenoxyethyl)benzamide (PubChem CID 141009593) has the molecular formula C22H19NO3 and a molecular weight of 345.40 g/mol. Its IUPAC name is 4-(2-formylphenyl)-N-(2-phenoxyethyl)benzamide.
| Compound Name | 4-(2-formylphenyl)-N-(2-phenoxyethyl)benzamide |
|---|---|
| PubChem CID | 141009593 |
| Molecular Formula | C22H19NO3 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | 4-(2-formylphenyl)-N-(2-phenoxyethyl)benzamide |
| SMILES | O=Cc1ccccc1-c1ccc(C(=O)NCCOc2ccccc2)cc1 |
| InChI | InChI=1S/C22H19NO3/c24-16-19-6-4-5-9-21(19)17-10-12-18(13-11-17)22(25)23-14-15-26-20-7-2-1-3-8-20/h1-13,16H,14-15H2,(H,23,25) |
| InChIKey | VHXKHIJBBSVRIT-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|