C27H25N3O2 — CID 46092004
4-(3,4-diazatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),4,10,12-pentaen-5-yl)-N-(2-phenoxyethyl)benzamide (PubChem CID 46092004) has the molecular formula C27H25N3O2 and a molecular weight of 423.52 g/mol. Its IUPAC name is 4-(3,4-diazatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),4,10,12-pentaen-5-yl)-N-(2-phenoxyethyl)benzamide.
| Compound Name | 4-(3,4-diazatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),4,10,12-pentaen-5-yl)-N-(2-phenoxyethyl)benzamide |
|---|---|
| PubChem CID | 46092004 |
| Molecular Formula | C27H25N3O2 |
| Molecular Weight | 423.52 g/mol |
| Exact Mass | 423.19 |
| IUPAC Name | 4-(3,4-diazatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),4,10,12-pentaen-5-yl)-N-(2-phenoxyethyl)benzamide |
| SMILES | O=C(NCCOc1ccccc1)c1ccc(-c2n[nH]c3c2CCCc2ccccc2-3)cc1 |
| InChI | InChI=1S/C27H25N3O2/c31-27(28-17-18-32-22-9-2-1-3-10-22)21-15-13-20(14-16-21)25-24-12-6-8-19-7-4-5-11-23(19)26(24)30-29-25/h1-5,7,9-11,13-16H,6,8,12,17-18H2,(H,28,31)(H,29,30) |
| InChIKey | XQKDUWGJAOTIMA-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.52 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|