C26H32N4O — CID 18415999
4-(1,4-dihydroindeno[2,1-d]pyrazol-3-yl)-N-[3-(dipropylamino)propyl]benzamide (PubChem CID 18415999) has the molecular formula C26H32N4O and a molecular weight of 416.57 g/mol. Its IUPAC name is 4-(1,4-dihydroindeno[2,1-d]pyrazol-3-yl)-N-[3-(dipropylamino)propyl]benzamide.
| Compound Name | 4-(1,4-dihydroindeno[2,1-d]pyrazol-3-yl)-N-[3-(dipropylamino)propyl]benzamide |
|---|---|
| PubChem CID | 18415999 |
| Molecular Formula | C26H32N4O |
| Molecular Weight | 416.57 g/mol |
| Exact Mass | 416.26 |
| IUPAC Name | 4-(1,4-dihydroindeno[2,1-d]pyrazol-3-yl)-N-[3-(dipropylamino)propyl]benzamide |
| SMILES | CCCN(CCC)CCCNC(=O)c1ccc(-c2n[nH]c3c2Cc2ccccc2-3)cc1 |
| InChI | InChI=1S/C26H32N4O/c1-3-15-30(16-4-2)17-7-14-27-26(31)20-12-10-19(11-13-20)24-23-18-21-8-5-6-9-22(21)25(23)29-28-24/h5-6,8-13H,3-4,7,14-18H2,1-2H3,(H,27,31)(H,28,29) |
| InChIKey | DSFBPILERYORIE-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.57 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|