C25H36O5 — CID 134217408
4-[(1S)-1-[(10R,13S,17S)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]ethoxy]-4-oxobutanoic acid (PubChem CID 134217408) has the molecular formula C25H36O5 and a molecular weight of 416.56 g/mol. Its IUPAC name is 4-[(1S)-1-[(10R,13S,17S)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]ethoxy]-4-oxobutanoic acid.
| Compound Name | 4-[(1S)-1-[(10R,13S,17S)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]ethoxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 134217408 |
| Molecular Formula | C25H36O5 |
| Molecular Weight | 416.56 g/mol |
| Exact Mass | 416.26 |
| IUPAC Name | 4-[(1S)-1-[(10R,13S,17S)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]ethoxy]-4-oxobutanoic acid |
| SMILES | C[C@H](OC(=O)CCC(=O)O)[C@H]1CCC2C3CCC4=CC(=O)CC[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C25H36O5/c1-15(30-23(29)9-8-22(27)28)19-6-7-20-18-5-4-16-14-17(26)10-12-24(16,2)21(18)11-13-25(19,20)3/h14-15,18-21H,4-13H2,1-3H3,(H,27,28)/t15-,18?,19+,20?,21?,24-,25+/m0/s1 |
| InChIKey | OHXRFBYLPVQYGT-SVAVDPJZSA-N |
| XLogP | 4.93 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.56 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |