C44H77N2O4+ — CID 134205091
2-[[4-[(1S)-1-[(10R,13S,17S)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]ethoxy]-4-oxobutanoyl]amino]ethyl-methyl-dioctylazanium (PubChem CID 134205091) has the molecular formula C44H77N2O4+ and a molecular weight of 698.11 g/mol. Its IUPAC name is 2-[[4-[(1S)-1-[(10R,13S,17S)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]ethoxy]-4-oxobutanoyl]amino]ethyl-methyl-dioctylazanium.
| Compound Name | 2-[[4-[(1S)-1-[(10R,13S,17S)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]ethoxy]-4-oxobutanoyl]amino]ethyl-methyl-dioctylazanium |
|---|---|
| PubChem CID | 134205091 |
| Molecular Formula | C44H77N2O4+ |
| Molecular Weight | 698.11 g/mol |
| Exact Mass | 697.59 |
| IUPAC Name | 2-[[4-[(1S)-1-[(10R,13S,17S)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]ethoxy]-4-oxobutanoyl]amino]ethyl-methyl-dioctylazanium |
| SMILES | CCCCCCCC[N+](C)(CCCCCCCC)CCNC(=O)CCC(=O)O[C@@H](C)[C@H]1CCC2C3CCC4=CC(=O)CC[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C44H76N2O4/c1-7-9-11-13-15-17-30-46(6,31-18-16-14-12-10-8-2)32-29-45-41(48)23-24-42(49)50-34(3)38-21-22-39-37-20-19-35-33-36(47)25-27-43(35,4)40(37)26-28-44(38,39)5/h33-34,37-40H,7-32H2,1-6H3/p+1/t34-,37?,38+,39?,40?,43-,44+/m0/s1 |
| InChIKey | FUYLOUQQZNLSAE-JXGGBDQSSA-O |
| XLogP | 10.13 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.11 |
| LogP ≤ 5 | 10.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|