C24H21BrCl3F2N3O — CID 134217514
2-bromo-N-[1-(cyanomethyl)piperidin-4-yl]-4-[(E)-4,4-difluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzamide (PubChem CID 134217514) has the molecular formula C24H21BrCl3F2N3O and a molecular weight of 591.71 g/mol. Its IUPAC name is 2-bromo-N-[1-(cyanomethyl)piperidin-4-yl]-4-[(E)-4,4-difluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzamide.
| Compound Name | 2-bromo-N-[1-(cyanomethyl)piperidin-4-yl]-4-[(E)-4,4-difluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzamide |
|---|---|
| PubChem CID | 134217514 |
| Molecular Formula | C24H21BrCl3F2N3O |
| Molecular Weight | 591.71 g/mol |
| Exact Mass | 588.99 |
| IUPAC Name | 2-bromo-N-[1-(cyanomethyl)piperidin-4-yl]-4-[(E)-4,4-difluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzamide |
| SMILES | N#CCN1CCC(NC(=O)c2ccc(/C=C/C(c3cc(Cl)c(Cl)c(Cl)c3)C(F)F)cc2Br)CC1 |
| InChI | InChI=1S/C24H21BrCl3F2N3O/c25-19-11-14(1-3-17(23(29)30)15-12-20(26)22(28)21(27)13-15)2-4-18(19)24(34)32-16-5-8-33(9-6-16)10-7-31/h1-4,11-13,16-17,23H,5-6,8-10H2,(H,32,34)/b3-1+ |
| InChIKey | BBZBSPCUFMWXNI-HNQUOIGGSA-N |
| XLogP | 7.19 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.71 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|