C37H27N3 — CID 134218170
2-(12,12-dimethyl-7H-indeno[1,2-a]fluoren-5-yl)-4,6-diphenyl-1,3,5-triazine (PubChem CID 134218170) has the molecular formula C37H27N3 and a molecular weight of 513.64 g/mol. Its IUPAC name is 2-(12,12-dimethyl-7H-indeno[1,2-a]fluoren-5-yl)-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-(12,12-dimethyl-7H-indeno[1,2-a]fluoren-5-yl)-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 134218170 |
| Molecular Formula | C37H27N3 |
| Molecular Weight | 513.64 g/mol |
| Exact Mass | 513.22 |
| IUPAC Name | 2-(12,12-dimethyl-7H-indeno[1,2-a]fluoren-5-yl)-4,6-diphenyl-1,3,5-triazine |
| SMILES | CC1(C)c2ccccc2-c2c(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)cc3c(c21)-c1ccccc1C3 |
| InChI | InChI=1S/C37H27N3/c1-37(2)30-20-12-11-19-28(30)32-29(22-26-21-25-17-9-10-18-27(25)31(26)33(32)37)36-39-34(23-13-5-3-6-14-23)38-35(40-36)24-15-7-4-8-16-24/h3-20,22H,21H2,1-2H3 |
| InChIKey | WKQBMXFWGQEPRW-UHFFFAOYSA-N |
| XLogP | 8.75 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.64 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |