C14H16O2S — CID 134219675
[(4Z,6Z)-octa-1,4,6-trien-3-yl]sulfonylbenzene (PubChem CID 134219675) has the molecular formula C14H16O2S and a molecular weight of 248.35 g/mol. Its IUPAC name is [(4Z,6Z)-octa-1,4,6-trien-3-yl]sulfonylbenzene.
| Compound Name | [(4Z,6Z)-octa-1,4,6-trien-3-yl]sulfonylbenzene |
|---|---|
| PubChem CID | 134219675 |
| Molecular Formula | C14H16O2S |
| Molecular Weight | 248.35 g/mol |
| Exact Mass | 248.09 |
| IUPAC Name | [(4Z,6Z)-octa-1,4,6-trien-3-yl]sulfonylbenzene |
| SMILES | C=CC(/C=C\C=C/C)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C14H16O2S/c1-3-5-7-10-13(4-2)17(15,16)14-11-8-6-9-12-14/h3-13H,2H2,1H3/b5-3-,10-7- |
| InChIKey | UEZGKSSOOSQDEI-TYWVWOHTSA-N |
| XLogP | 3.15 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.35 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|