C17H37N5 — CID 134220098
[7-amino-7-(1-methylcyclodecyl)-1,3-diazepan-4-yl]methanediamine (PubChem CID 134220098) has the molecular formula C17H37N5 and a molecular weight of 311.52 g/mol. Its IUPAC name is [7-amino-7-(1-methylcyclodecyl)-1,3-diazepan-4-yl]methanediamine.
| Compound Name | [7-amino-7-(1-methylcyclodecyl)-1,3-diazepan-4-yl]methanediamine |
|---|---|
| PubChem CID | 134220098 |
| Molecular Formula | C17H37N5 |
| Molecular Weight | 311.52 g/mol |
| Exact Mass | 311.30 |
| IUPAC Name | [7-amino-7-(1-methylcyclodecyl)-1,3-diazepan-4-yl]methanediamine |
| SMILES | CC1(C2(N)CCC(C(N)N)NCN2)CCCCCCCCC1 |
| InChI | InChI=1S/C17H37N5/c1-16(10-7-5-3-2-4-6-8-11-16)17(20)12-9-14(15(18)19)21-13-22-17/h14-15,21-22H,2-13,18-20H2,1H3 |
| InChIKey | WNPGRSUIEXDBBI-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 102.12 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.52 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|