C12H15NO3 — CID 134221370
[(3S,4S)-4-amino-3-methyl-3,4-dihydro-1H-isochromen-7-yl] acetate (PubChem CID 134221370) has the molecular formula C12H15NO3 and a molecular weight of 221.26 g/mol. Its IUPAC name is [(3S,4S)-4-amino-3-methyl-3,4-dihydro-1H-isochromen-7-yl] acetate.
| Compound Name | [(3S,4S)-4-amino-3-methyl-3,4-dihydro-1H-isochromen-7-yl] acetate |
|---|---|
| PubChem CID | 134221370 |
| Molecular Formula | C12H15NO3 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.11 |
| IUPAC Name | [(3S,4S)-4-amino-3-methyl-3,4-dihydro-1H-isochromen-7-yl] acetate |
| SMILES | CC(=O)Oc1ccc2c(c1)CO[C@@H](C)[C@H]2N |
| InChI | InChI=1S/C12H15NO3/c1-7-12(13)11-4-3-10(16-8(2)14)5-9(11)6-15-7/h3-5,7,12H,6,13H2,1-2H3/t7-,12+/m0/s1 |
| InChIKey | NNDDTSBRNMAIQY-JVXZTZIISA-N |
| XLogP | 1.53 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|