About [(3S,4S)-4-amino-3-methyl-3,4-dihydro-1H-isochromen-7-yl] acetate
[(3S,4S)-4-amino-3-methyl-3,4-dihydro-1H-isochromen-7-yl] acetate (PubChem CID 134221370) has the molecular formula C12H15NO3
and a molecular weight of 221.26 g/mol. Its IUPAC name is [(3S,4S)-4-amino-3-methyl-3,4-dihydro-1H-isochromen-7-yl] acetate.
Molecular Properties
| Compound Name | [(3S,4S)-4-amino-3-methyl-3,4-dihydro-1H-isochromen-7-yl] acetate |
| PubChem CID | 134221370 |
| Molecular Formula | C12H15NO3 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.11 |
| IUPAC Name | [(3S,4S)-4-amino-3-methyl-3,4-dihydro-1H-isochromen-7-yl] acetate |
| SMILES | CC(=O)Oc1ccc2c(c1)CO[C@@H](C)[C@H]2N |
| InChI | InChI=1S/C12H15NO3/c1-7-12(13)11-4-3-10(16-8(2)14)5-9(11)6-15-7/h3-5,7,12H,6,13H2,1-2H3/t7-,12+/m0/s1 |
| InChIKey | NNDDTSBRNMAIQY-JVXZTZIISA-N |
| XLogP | 1.53 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [(3S,4S)-4-amino-3-methyl-3,4-dihydro-1H-isochromen-7-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3S,4S)-4-amino-3-methyl-3,4-dihydro-1H-isochromen-7-yl] acetate?
The IUPAC name of [(3S,4S)-4-amino-3-methyl-3,4-dihydro-1H-isochromen-7-yl] acetate (CID 134221370) is [(3S,4S)-4-amino-3-methyl-3,4-dihydro-1H-isochromen-7-yl] acetate.
What is the SMILES notation for [(3S,4S)-4-amino-3-methyl-3,4-dihydro-1H-isochromen-7-yl] acetate?
The canonical SMILES for [(3S,4S)-4-amino-3-methyl-3,4-dihydro-1H-isochromen-7-yl] acetate is CC(=O)Oc1ccc2c(c1)CO[C@@H](C)[C@H]2N.
What is the InChIKey of [(3S,4S)-4-amino-3-methyl-3,4-dihydro-1H-isochromen-7-yl] acetate?
The InChIKey is NNDDTSBRNMAIQY-JVXZTZIISA-N. The full InChI is InChI=1S/C12H15NO3/c1-7-12(13)11-4-3-10(16-8(2)14)5-9(11)6-15-7/h3-5,7,12H,6,13H2,1-2H3/t7-,12+/m0/s1.
What are the key properties of [(3S,4S)-4-amino-3-methyl-3,4-dihydro-1H-isochromen-7-yl] acetate?
[(3S,4S)-4-amino-3-methyl-3,4-dihydro-1H-isochromen-7-yl] acetate has a molecular weight of 221.26 g/mol, XLogP of 1.53, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(3S,4S)-4-amino-3-methyl-3,4-dihydro-1H-isochromen-7-yl] acetate is sourced from PubChem (CID 134221370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).