C28H28N2O6S — CID 134221789
benzyl 5-[[4-[(3Z,5E)-6-methyl-3-(methylideneamino)-2-oxoocta-3,5-dienoxy]phenyl]methyl]-2,4-dioxo-1,3-thiazolidine-5-carboxylate (PubChem CID 134221789) has the molecular formula C28H28N2O6S and a molecular weight of 520.61 g/mol. Its IUPAC name is benzyl 5-[[4-[(3Z,5E)-6-methyl-3-(methylideneamino)-2-oxoocta-3,5-dienoxy]phenyl]methyl]-2,4-dioxo-1,3-thiazolidine-5-carboxylate.
| Compound Name | benzyl 5-[[4-[(3Z,5E)-6-methyl-3-(methylideneamino)-2-oxoocta-3,5-dienoxy]phenyl]methyl]-2,4-dioxo-1,3-thiazolidine-5-carboxylate |
|---|---|
| PubChem CID | 134221789 |
| Molecular Formula | C28H28N2O6S |
| Molecular Weight | 520.61 g/mol |
| Exact Mass | 520.17 |
| IUPAC Name | benzyl 5-[[4-[(3Z,5E)-6-methyl-3-(methylideneamino)-2-oxoocta-3,5-dienoxy]phenyl]methyl]-2,4-dioxo-1,3-thiazolidine-5-carboxylate |
| SMILES | C=N/C(=C\C=C(/C)CC)C(=O)COc1ccc(CC2(C(=O)OCc3ccccc3)SC(=O)NC2=O)cc1 |
| InChI | InChI=1S/C28H28N2O6S/c1-4-19(2)10-15-23(29-3)24(31)18-35-22-13-11-20(12-14-22)16-28(25(32)30-27(34)37-28)26(33)36-17-21-8-6-5-7-9-21/h5-15H,3-4,16-18H2,1-2H3,(H,30,32,34)/b19-10+,23-15- |
| InChIKey | AIVLHCPKSPDCRR-GAPCOFBTSA-N |
| XLogP | 4.58 |
| TPSA | 111.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.61 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|