C34H32N2O7S — CID 155057990
benzyl (5R)-5-[[4-[2-[3-(4-methoxyphenoxy)-N-methylanilino]ethoxy]phenyl]methyl]-2,4-dioxo-1,3-thiazolidine-5-carboxylate (PubChem CID 155057990) has the molecular formula C34H32N2O7S and a molecular weight of 612.70 g/mol. Its IUPAC name is benzyl (5R)-5-[[4-[2-[3-(4-methoxyphenoxy)-N-methylanilino]ethoxy]phenyl]methyl]-2,4-dioxo-1,3-thiazolidine-5-carboxylate.
| Compound Name | benzyl (5R)-5-[[4-[2-[3-(4-methoxyphenoxy)-N-methylanilino]ethoxy]phenyl]methyl]-2,4-dioxo-1,3-thiazolidine-5-carboxylate |
|---|---|
| PubChem CID | 155057990 |
| Molecular Formula | C34H32N2O7S |
| Molecular Weight | 612.70 g/mol |
| Exact Mass | 612.19 |
| IUPAC Name | benzyl (5R)-5-[[4-[2-[3-(4-methoxyphenoxy)-N-methylanilino]ethoxy]phenyl]methyl]-2,4-dioxo-1,3-thiazolidine-5-carboxylate |
| SMILES | COc1ccc(Oc2cccc(N(C)CCOc3ccc(C[C@@]4(C(=O)OCc5ccccc5)SC(=O)NC4=O)cc3)c2)cc1 |
| InChI | InChI=1S/C34H32N2O7S/c1-36(26-9-6-10-30(21-26)43-29-17-15-27(40-2)16-18-29)19-20-41-28-13-11-24(12-14-28)22-34(31(37)35-33(39)44-34)32(38)42-23-25-7-4-3-5-8-25/h3-18,21H,19-20,22-23H2,1-2H3,(H,35,37,39)/t34-/m1/s1 |
| InChIKey | RKLOTWCSRZFHQI-UUWRZZSWSA-N |
| XLogP | 6.01 |
| TPSA | 103.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.70 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|