C32H30N4O7S — CID 134485987
benzyl (5S)-5-[[4-[2-[[6-(4-methoxyphenoxy)pyrimidin-4-yl]-methylamino]ethoxy]phenyl]methyl]-2,4-dioxo-1,3-thiazolidine-5-carboxylate (PubChem CID 134485987) has the molecular formula C32H30N4O7S and a molecular weight of 614.68 g/mol. Its IUPAC name is benzyl (5S)-5-[[4-[2-[[6-(4-methoxyphenoxy)pyrimidin-4-yl]-methylamino]ethoxy]phenyl]methyl]-2,4-dioxo-1,3-thiazolidine-5-carboxylate.
| Compound Name | benzyl (5S)-5-[[4-[2-[[6-(4-methoxyphenoxy)pyrimidin-4-yl]-methylamino]ethoxy]phenyl]methyl]-2,4-dioxo-1,3-thiazolidine-5-carboxylate |
|---|---|
| PubChem CID | 134485987 |
| Molecular Formula | C32H30N4O7S |
| Molecular Weight | 614.68 g/mol |
| Exact Mass | 614.18 |
| IUPAC Name | benzyl (5S)-5-[[4-[2-[[6-(4-methoxyphenoxy)pyrimidin-4-yl]-methylamino]ethoxy]phenyl]methyl]-2,4-dioxo-1,3-thiazolidine-5-carboxylate |
| SMILES | COc1ccc(Oc2cc(N(C)CCOc3ccc(C[C@]4(C(=O)OCc5ccccc5)SC(=O)NC4=O)cc3)ncn2)cc1 |
| InChI | InChI=1S/C32H30N4O7S/c1-36(27-18-28(34-21-33-27)43-26-14-12-24(40-2)13-15-26)16-17-41-25-10-8-22(9-11-25)19-32(29(37)35-31(39)44-32)30(38)42-20-23-6-4-3-5-7-23/h3-15,18,21H,16-17,19-20H2,1-2H3,(H,35,37,39)/t32-/m0/s1 |
| InChIKey | STMQFCQDOBKADS-YTTGMZPUSA-N |
| XLogP | 4.80 |
| TPSA | 129.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.68 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|