C11H15NO — CID 134223005
(4S)-N,5-dimethyl-3,4-dihydro-1H-isochromen-4-amine (PubChem CID 134223005) has the molecular formula C11H15NO and a molecular weight of 177.25 g/mol. Its IUPAC name is (4S)-N,5-dimethyl-3,4-dihydro-1H-isochromen-4-amine.
| Compound Name | (4S)-N,5-dimethyl-3,4-dihydro-1H-isochromen-4-amine |
|---|---|
| PubChem CID | 134223005 |
| Molecular Formula | C11H15NO |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.12 |
| IUPAC Name | (4S)-N,5-dimethyl-3,4-dihydro-1H-isochromen-4-amine |
| SMILES | CN[C@@H]1COCc2cccc(C)c21 |
| InChI | InChI=1S/C11H15NO/c1-8-4-3-5-9-6-13-7-10(12-2)11(8)9/h3-5,10,12H,6-7H2,1-2H3/t10-/m1/s1 |
| InChIKey | HUOCEQNZHFFOBI-SNVBAGLBSA-N |
| XLogP | 1.79 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |