About (4S)-N,5-dimethyl-3,4-dihydro-1H-isochromen-4-amine
(4S)-N,5-dimethyl-3,4-dihydro-1H-isochromen-4-amine (PubChem CID 134223005) has the molecular formula C11H15NO
and a molecular weight of 177.25 g/mol. Its IUPAC name is (4S)-N,5-dimethyl-3,4-dihydro-1H-isochromen-4-amine.
Molecular Properties
| Compound Name | (4S)-N,5-dimethyl-3,4-dihydro-1H-isochromen-4-amine |
| PubChem CID | 134223005 |
| Molecular Formula | C11H15NO |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.12 |
| IUPAC Name | (4S)-N,5-dimethyl-3,4-dihydro-1H-isochromen-4-amine |
| SMILES | CN[C@@H]1COCc2cccc(C)c21 |
| InChI | InChI=1S/C11H15NO/c1-8-4-3-5-9-6-13-7-10(12-2)11(8)9/h3-5,10,12H,6-7H2,1-2H3/t10-/m1/s1 |
| InChIKey | HUOCEQNZHFFOBI-SNVBAGLBSA-N |
| XLogP | 1.79 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4S)-N,5-dimethyl-3,4-dihydro-1H-isochromen-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-N,5-dimethyl-3,4-dihydro-1H-isochromen-4-amine?
The IUPAC name of (4S)-N,5-dimethyl-3,4-dihydro-1H-isochromen-4-amine (CID 134223005) is (4S)-N,5-dimethyl-3,4-dihydro-1H-isochromen-4-amine.
What is the SMILES notation for (4S)-N,5-dimethyl-3,4-dihydro-1H-isochromen-4-amine?
The canonical SMILES for (4S)-N,5-dimethyl-3,4-dihydro-1H-isochromen-4-amine is CN[C@@H]1COCc2cccc(C)c21.
What is the InChIKey of (4S)-N,5-dimethyl-3,4-dihydro-1H-isochromen-4-amine?
The InChIKey is HUOCEQNZHFFOBI-SNVBAGLBSA-N. The full InChI is InChI=1S/C11H15NO/c1-8-4-3-5-9-6-13-7-10(12-2)11(8)9/h3-5,10,12H,6-7H2,1-2H3/t10-/m1/s1.
What are the key properties of (4S)-N,5-dimethyl-3,4-dihydro-1H-isochromen-4-amine?
(4S)-N,5-dimethyl-3,4-dihydro-1H-isochromen-4-amine has a molecular weight of 177.25 g/mol, XLogP of 1.79, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-N,5-dimethyl-3,4-dihydro-1H-isochromen-4-amine is sourced from PubChem (CID 134223005), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).