C12H9ClF3NO2 — CID 13423081
2-(1-chloropropyl)-8-(trifluoromethyl)-3,1-benzoxazin-4-one (PubChem CID 13423081) has the molecular formula C12H9ClF3NO2 and a molecular weight of 291.66 g/mol. Its IUPAC name is 2-(1-chloropropyl)-8-(trifluoromethyl)-3,1-benzoxazin-4-one.
| Compound Name | 2-(1-chloropropyl)-8-(trifluoromethyl)-3,1-benzoxazin-4-one |
|---|---|
| PubChem CID | 13423081 |
| Molecular Formula | C12H9ClF3NO2 |
| Molecular Weight | 291.66 g/mol |
| Exact Mass | 291.03 |
| IUPAC Name | 2-(1-chloropropyl)-8-(trifluoromethyl)-3,1-benzoxazin-4-one |
| SMILES | CCC(Cl)c1nc2c(C(F)(F)F)cccc2c(=O)o1 |
| InChI | InChI=1S/C12H9ClF3NO2/c1-2-8(13)10-17-9-6(11(18)19-10)4-3-5-7(9)12(14,15)16/h3-5,8H,2H2,1H3 |
| InChIKey | FCZXFTQRMCBGLM-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.66 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|