C28H21F3N4O — CID 134231329
2-anilino-N-[4-[2-naphthalen-1-yl-4-(trifluoromethyl)imidazol-1-yl]phenyl]acetamide (PubChem CID 134231329) has the molecular formula C28H21F3N4O and a molecular weight of 486.50 g/mol. Its IUPAC name is 2-anilino-N-[4-[2-naphthalen-1-yl-4-(trifluoromethyl)imidazol-1-yl]phenyl]acetamide.
| Compound Name | 2-anilino-N-[4-[2-naphthalen-1-yl-4-(trifluoromethyl)imidazol-1-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 134231329 |
| Molecular Formula | C28H21F3N4O |
| Molecular Weight | 486.50 g/mol |
| Exact Mass | 486.17 |
| IUPAC Name | 2-anilino-N-[4-[2-naphthalen-1-yl-4-(trifluoromethyl)imidazol-1-yl]phenyl]acetamide |
| SMILES | O=C(CNc1ccccc1)Nc1ccc(-n2cc(C(F)(F)F)nc2-c2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C28H21F3N4O/c29-28(30,31)25-18-35(27(34-25)24-12-6-8-19-7-4-5-11-23(19)24)22-15-13-21(14-16-22)33-26(36)17-32-20-9-2-1-3-10-20/h1-16,18,32H,17H2,(H,33,36) |
| InChIKey | NFGFVJBBZBYUNZ-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.50 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |