C27H21F3N4O — CID 134231263
2-(methylamino)-N-[4-[2-phenanthren-2-yl-4-(trifluoromethyl)imidazol-1-yl]phenyl]acetamide (PubChem CID 134231263) has the molecular formula C27H21F3N4O and a molecular weight of 474.49 g/mol. Its IUPAC name is 2-(methylamino)-N-[4-[2-phenanthren-2-yl-4-(trifluoromethyl)imidazol-1-yl]phenyl]acetamide.
| Compound Name | 2-(methylamino)-N-[4-[2-phenanthren-2-yl-4-(trifluoromethyl)imidazol-1-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 134231263 |
| Molecular Formula | C27H21F3N4O |
| Molecular Weight | 474.49 g/mol |
| Exact Mass | 474.17 |
| IUPAC Name | 2-(methylamino)-N-[4-[2-phenanthren-2-yl-4-(trifluoromethyl)imidazol-1-yl]phenyl]acetamide |
| SMILES | CNCC(=O)Nc1ccc(-n2cc(C(F)(F)F)nc2-c2ccc3c(ccc4ccccc43)c2)cc1 |
| InChI | InChI=1S/C27H21F3N4O/c1-31-15-25(35)32-20-9-11-21(12-10-20)34-16-24(27(28,29)30)33-26(34)19-8-13-23-18(14-19)7-6-17-4-2-3-5-22(17)23/h2-14,16,31H,15H2,1H3,(H,32,35) |
| InChIKey | HLUSRQMNVYVALC-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.49 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|