C24H45Cl2N3O3 — CID 134231508
(2S)-6-amino-2-(benzylamino)-N-(2-heptoxy-3-methoxypropyl)hexanamide;dihydrochloride (PubChem CID 134231508) has the molecular formula C24H45Cl2N3O3 and a molecular weight of 494.55 g/mol. Its IUPAC name is (2S)-6-amino-2-(benzylamino)-N-(2-heptoxy-3-methoxypropyl)hexanamide;dihydrochloride.
| Compound Name | (2S)-6-amino-2-(benzylamino)-N-(2-heptoxy-3-methoxypropyl)hexanamide;dihydrochloride |
|---|---|
| PubChem CID | 134231508 |
| Molecular Formula | C24H45Cl2N3O3 |
| Molecular Weight | 494.55 g/mol |
| Exact Mass | 493.28 |
| IUPAC Name | (2S)-6-amino-2-(benzylamino)-N-(2-heptoxy-3-methoxypropyl)hexanamide;dihydrochloride |
| SMILES | CCCCCCCOC(CNC(=O)[C@H](CCCCN)NCc1ccccc1)COC.Cl.Cl |
| InChI | InChI=1S/C24H43N3O3.2ClH/c1-3-4-5-6-12-17-30-22(20-29-2)19-27-24(28)23(15-10-11-16-25)26-18-21-13-8-7-9-14-21;;/h7-9,13-14,22-23,26H,3-6,10-12,15-20,25H2,1-2H3,(H,27,28);2*1H/t22?,23-;;/m0../s1 |
| InChIKey | GUHFZNLJKICHIR-OLBPYZPGSA-N |
| XLogP | 4.24 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.55 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|