C30H57Cl2N3O3 — CID 134231468
(2S)-6-amino-2-(benzylamino)-N-(2,3-diheptoxypropyl)hexanamide;dihydrochloride (PubChem CID 134231468) has the molecular formula C30H57Cl2N3O3 and a molecular weight of 578.71 g/mol. Its IUPAC name is (2S)-6-amino-2-(benzylamino)-N-(2,3-diheptoxypropyl)hexanamide;dihydrochloride.
| Compound Name | (2S)-6-amino-2-(benzylamino)-N-(2,3-diheptoxypropyl)hexanamide;dihydrochloride |
|---|---|
| PubChem CID | 134231468 |
| Molecular Formula | C30H57Cl2N3O3 |
| Molecular Weight | 578.71 g/mol |
| Exact Mass | 577.38 |
| IUPAC Name | (2S)-6-amino-2-(benzylamino)-N-(2,3-diheptoxypropyl)hexanamide;dihydrochloride |
| SMILES | CCCCCCCOCC(CNC(=O)[C@H](CCCCN)NCc1ccccc1)OCCCCCCC.Cl.Cl |
| InChI | InChI=1S/C30H55N3O3.2ClH/c1-3-5-7-9-16-22-35-26-28(36-23-17-10-8-6-4-2)25-33-30(34)29(20-14-15-21-31)32-24-27-18-12-11-13-19-27;;/h11-13,18-19,28-29,32H,3-10,14-17,20-26,31H2,1-2H3,(H,33,34);2*1H/t28?,29-;;/m0../s1 |
| InChIKey | QXCRXDVNBMERBS-NTAMSTPQSA-N |
| XLogP | 6.58 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.71 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|