C24H43N3O3 — CID 142044556
2-[(4-aminobutylamino)-hydroxymethyl]-N-butyl-8-phenylmethoxyoctanamide (PubChem CID 142044556) has the molecular formula C24H43N3O3 and a molecular weight of 421.63 g/mol. Its IUPAC name is 2-[(4-aminobutylamino)-hydroxymethyl]-N-butyl-8-phenylmethoxyoctanamide.
| Compound Name | 2-[(4-aminobutylamino)-hydroxymethyl]-N-butyl-8-phenylmethoxyoctanamide |
|---|---|
| PubChem CID | 142044556 |
| Molecular Formula | C24H43N3O3 |
| Molecular Weight | 421.63 g/mol |
| Exact Mass | 421.33 |
| IUPAC Name | 2-[(4-aminobutylamino)-hydroxymethyl]-N-butyl-8-phenylmethoxyoctanamide |
| SMILES | CCCCNC(=O)C(CCCCCCOCc1ccccc1)C(O)NCCCCN |
| InChI | InChI=1S/C24H43N3O3/c1-2-3-17-26-23(28)22(24(29)27-18-11-10-16-25)15-9-4-5-12-19-30-20-21-13-7-6-8-14-21/h6-8,13-14,22,24,27,29H,2-5,9-12,15-20,25H2,1H3,(H,26,28) |
| InChIKey | BVFAOQWZLYZQGK-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.63 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|