C28H53N3O5 — CID 142284000
2-(benzylamino)-N-[2,3-bis(5-methoxypentoxy)propyl]acetamide;butan-1-amine (PubChem CID 142284000) has the molecular formula C28H53N3O5 and a molecular weight of 511.75 g/mol. Its IUPAC name is 2-(benzylamino)-N-[2,3-bis(5-methoxypentoxy)propyl]acetamide;butan-1-amine.
| Compound Name | 2-(benzylamino)-N-[2,3-bis(5-methoxypentoxy)propyl]acetamide;butan-1-amine |
|---|---|
| PubChem CID | 142284000 |
| Molecular Formula | C28H53N3O5 |
| Molecular Weight | 511.75 g/mol |
| Exact Mass | 511.40 |
| IUPAC Name | 2-(benzylamino)-N-[2,3-bis(5-methoxypentoxy)propyl]acetamide;butan-1-amine |
| SMILES | CCCCN.COCCCCCOCC(CNC(=O)CNCc1ccccc1)OCCCCCOC |
| InChI | InChI=1S/C24H42N2O5.C4H11N/c1-28-14-8-4-10-16-30-21-23(31-17-11-5-9-15-29-2)19-26-24(27)20-25-18-22-12-6-3-7-13-22;1-2-3-4-5/h3,6-7,12-13,23,25H,4-5,8-11,14-21H2,1-2H3,(H,26,27);2-5H2,1H3 |
| InChIKey | NSYNLHLOLMYXPQ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 104.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.75 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|