C17H24N2OS — CID 134232736
3-ethyl-N-[(5-methyl-2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]hex-5-en-1-amine (PubChem CID 134232736) has the molecular formula C17H24N2OS and a molecular weight of 304.46 g/mol. Its IUPAC name is 3-ethyl-N-[(5-methyl-2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]hex-5-en-1-amine.
| Compound Name | 3-ethyl-N-[(5-methyl-2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]hex-5-en-1-amine |
|---|---|
| PubChem CID | 134232736 |
| Molecular Formula | C17H24N2OS |
| Molecular Weight | 304.46 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | 3-ethyl-N-[(5-methyl-2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]hex-5-en-1-amine |
| SMILES | C=CCC(CC)CCNCc1nc(-c2cccs2)oc1C |
| InChI | InChI=1S/C17H24N2OS/c1-4-7-14(5-2)9-10-18-12-15-13(3)20-17(19-15)16-8-6-11-21-16/h4,6,8,11,14,18H,1,5,7,9-10,12H2,2-3H3 |
| InChIKey | CIHFMOLELJREIJ-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.46 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|