C28H48N2O12 — CID 134233132
(2,5-dioxopyrrolidin-1-yl) 6-[4-[(2S,3S,6S)-3-hydroxy-6-methyloxan-2-yl]butyl-[2-[(2S,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethyl]amino]hexanoate (PubChem CID 134233132) has the molecular formula C28H48N2O12 and a molecular weight of 604.69 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 6-[4-[(2S,3S,6S)-3-hydroxy-6-methyloxan-2-yl]butyl-[2-[(2S,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethyl]amino]hexanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 6-[4-[(2S,3S,6S)-3-hydroxy-6-methyloxan-2-yl]butyl-[2-[(2S,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethyl]amino]hexanoate |
|---|---|
| PubChem CID | 134233132 |
| Molecular Formula | C28H48N2O12 |
| Molecular Weight | 604.69 g/mol |
| Exact Mass | 604.32 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 6-[4-[(2S,3S,6S)-3-hydroxy-6-methyloxan-2-yl]butyl-[2-[(2S,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethyl]amino]hexanoate |
| SMILES | C[C@H]1CC[C@H](O)[C@H](CCCCN(CCCCCC(=O)ON2C(=O)CCC2=O)CCO[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]2O)O1 |
| InChI | InChI=1S/C28H48N2O12/c1-18-9-10-19(32)20(40-18)7-4-6-14-29(15-16-39-28-27(38)26(37)25(36)21(17-31)41-28)13-5-2-3-8-24(35)42-30-22(33)11-12-23(30)34/h18-21,25-28,31-32,36-38H,2-17H2,1H3/t18-,19-,20-,21+,25+,26-,27-,28-/m0/s1 |
| InChIKey | KLUWOEFZPNZUPF-BYEVOOQVSA-N |
| XLogP | -0.63 |
| TPSA | 195.76 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.69 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|