C30H50N2O14 — CID 144823214
(2,5-dioxopyrrolidin-1-yl) 10-[2-(3-hydroxyoxan-2-yl)oxyethyl-[3-[(2S,5S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl]amino]-10-oxodecanoate (PubChem CID 144823214) has the molecular formula C30H50N2O14 and a molecular weight of 662.73 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 10-[2-(3-hydroxyoxan-2-yl)oxyethyl-[3-[(2S,5S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl]amino]-10-oxodecanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 10-[2-(3-hydroxyoxan-2-yl)oxyethyl-[3-[(2S,5S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl]amino]-10-oxodecanoate |
|---|---|
| PubChem CID | 144823214 |
| Molecular Formula | C30H50N2O14 |
| Molecular Weight | 662.73 g/mol |
| Exact Mass | 662.33 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 10-[2-(3-hydroxyoxan-2-yl)oxyethyl-[3-[(2S,5S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl]amino]-10-oxodecanoate |
| SMILES | O=C(CCCCCCCCC(=O)N(CCCO[C@H]1OC(CO)[C@@H](O)C(O)C1O)CCOC1OCCCC1O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C30H50N2O14/c33-19-21-26(39)27(40)28(41)30(45-21)43-17-8-14-31(15-18-44-29-20(34)9-7-16-42-29)22(35)10-5-3-1-2-4-6-11-25(38)46-32-23(36)12-13-24(32)37/h20-21,26-30,33-34,39-41H,1-19H2/t20?,21?,26-,27?,28?,29?,30+/m1/s1 |
| InChIKey | KRHMNPVZXQNOKG-HQDJCMANSA-N |
| XLogP | -0.74 |
| TPSA | 222.06 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.73 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|