C14H21NO10 — CID 102588416
(2,5-dioxopyrrolidin-1-yl) 4-[(2S,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybutanoate (PubChem CID 102588416) has the molecular formula C14H21NO10 and a molecular weight of 363.32 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 4-[(2S,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybutanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 4-[(2S,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybutanoate |
|---|---|
| PubChem CID | 102588416 |
| Molecular Formula | C14H21NO10 |
| Molecular Weight | 363.32 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 4-[(2S,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybutanoate |
| SMILES | O=C(CCCO[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]1O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C14H21NO10/c16-6-7-11(20)12(21)13(22)14(24-7)23-5-1-2-10(19)25-15-8(17)3-4-9(15)18/h7,11-14,16,20-22H,1-6H2/t7-,11-,12+,13+,14+/m1/s1 |
| InChIKey | IOGLKTWGDFFTAD-NJHYNOGISA-N |
| XLogP | -2.81 |
| TPSA | 163.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.32 |
| LogP ≤ 5 | -2.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|