C5H10O5 — CID 134233154
(3R,4S,6R)-6-hydroperoxyoxane-3,4-diol (PubChem CID 134233154) has the molecular formula C5H10O5 and a molecular weight of 150.13 g/mol. Its IUPAC name is (3R,4S,6R)-6-hydroperoxyoxane-3,4-diol.
| Compound Name | (3R,4S,6R)-6-hydroperoxyoxane-3,4-diol |
|---|---|
| PubChem CID | 134233154 |
| Molecular Formula | C5H10O5 |
| Molecular Weight | 150.13 g/mol |
| Exact Mass | 150.05 |
| IUPAC Name | (3R,4S,6R)-6-hydroperoxyoxane-3,4-diol |
| SMILES | OO[C@@H]1C[C@H](O)[C@H](O)CO1 |
| InChI | InChI=1S/C5H10O5/c6-3-1-5(10-8)9-2-4(3)7/h3-8H,1-2H2/t3-,4+,5+/m0/s1 |
| InChIKey | WPXAKEYBLBVSQD-VPENINKCSA-N |
| XLogP | -1.06 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.13 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|