C15H18N2O5 — CID 134233787
N-ethyl-4,6-dihydroxy-2-oxo-1-propoxyquinoline-3-carboxamide (PubChem CID 134233787) has the molecular formula C15H18N2O5 and a molecular weight of 306.32 g/mol. Its IUPAC name is N-ethyl-4,6-dihydroxy-2-oxo-1-propoxyquinoline-3-carboxamide.
| Compound Name | N-ethyl-4,6-dihydroxy-2-oxo-1-propoxyquinoline-3-carboxamide |
|---|---|
| PubChem CID | 134233787 |
| Molecular Formula | C15H18N2O5 |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | N-ethyl-4,6-dihydroxy-2-oxo-1-propoxyquinoline-3-carboxamide |
| SMILES | CCCOn1c(=O)c(C(=O)NCC)c(O)c2cc(O)ccc21 |
| InChI | InChI=1S/C15H18N2O5/c1-3-7-22-17-11-6-5-9(18)8-10(11)13(19)12(15(17)21)14(20)16-4-2/h5-6,8,18-19H,3-4,7H2,1-2H3,(H,16,20) |
| InChIKey | DHNJHNSXYCDAMB-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 100.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |