About N-ethyl-4,6-dihydroxy-2-oxo-1-propoxyquinoline-3-carboxamide
N-ethyl-4,6-dihydroxy-2-oxo-1-propoxyquinoline-3-carboxamide (PubChem CID 134233787) has the molecular formula C15H18N2O5
and a molecular weight of 306.32 g/mol. Its IUPAC name is N-ethyl-4,6-dihydroxy-2-oxo-1-propoxyquinoline-3-carboxamide.
Molecular Properties
| Compound Name | N-ethyl-4,6-dihydroxy-2-oxo-1-propoxyquinoline-3-carboxamide |
| PubChem CID | 134233787 |
| Molecular Formula | C15H18N2O5 |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | N-ethyl-4,6-dihydroxy-2-oxo-1-propoxyquinoline-3-carboxamide |
| SMILES | CCCOn1c(=O)c(C(=O)NCC)c(O)c2cc(O)ccc21 |
| InChI | InChI=1S/C15H18N2O5/c1-3-7-22-17-11-6-5-9(18)8-10(11)13(19)12(15(17)21)14(20)16-4-2/h5-6,8,18-19H,3-4,7H2,1-2H3,(H,16,20) |
| InChIKey | DHNJHNSXYCDAMB-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 100.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-ethyl-4,6-dihydroxy-2-oxo-1-propoxyquinoline-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-4,6-dihydroxy-2-oxo-1-propoxyquinoline-3-carboxamide?
The IUPAC name of N-ethyl-4,6-dihydroxy-2-oxo-1-propoxyquinoline-3-carboxamide (CID 134233787) is N-ethyl-4,6-dihydroxy-2-oxo-1-propoxyquinoline-3-carboxamide.
What is the SMILES notation for N-ethyl-4,6-dihydroxy-2-oxo-1-propoxyquinoline-3-carboxamide?
The canonical SMILES for N-ethyl-4,6-dihydroxy-2-oxo-1-propoxyquinoline-3-carboxamide is CCCOn1c(=O)c(C(=O)NCC)c(O)c2cc(O)ccc21.
What is the InChIKey of N-ethyl-4,6-dihydroxy-2-oxo-1-propoxyquinoline-3-carboxamide?
The InChIKey is DHNJHNSXYCDAMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N2O5/c1-3-7-22-17-11-6-5-9(18)8-10(11)13(19)12(15(17)21)14(20)16-4-2/h5-6,8,18-19H,3-4,7H2,1-2H3,(H,16,20).
What are the key properties of N-ethyl-4,6-dihydroxy-2-oxo-1-propoxyquinoline-3-carboxamide?
N-ethyl-4,6-dihydroxy-2-oxo-1-propoxyquinoline-3-carboxamide has a molecular weight of 306.32 g/mol, XLogP of 1.00, 5 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-4,6-dihydroxy-2-oxo-1-propoxyquinoline-3-carboxamide is sourced from PubChem (CID 134233787), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).