C13H14N2O5 — CID 151201427
4,6-dihydroxy-2-oxo-1-propoxyquinoline-3-carboxamide (PubChem CID 151201427) has the molecular formula C13H14N2O5 and a molecular weight of 278.26 g/mol. Its IUPAC name is 4,6-dihydroxy-2-oxo-1-propoxyquinoline-3-carboxamide.
| Compound Name | 4,6-dihydroxy-2-oxo-1-propoxyquinoline-3-carboxamide |
|---|---|
| PubChem CID | 151201427 |
| Molecular Formula | C13H14N2O5 |
| Molecular Weight | 278.26 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | 4,6-dihydroxy-2-oxo-1-propoxyquinoline-3-carboxamide |
| SMILES | CCCOn1c(=O)c(C(N)=O)c(O)c2cc(O)ccc21 |
| InChI | InChI=1S/C13H14N2O5/c1-2-5-20-15-9-4-3-7(16)6-8(9)11(17)10(12(14)18)13(15)19/h3-4,6,16-17H,2,5H2,1H3,(H2,14,18) |
| InChIKey | NIJUYUDMTDMRSH-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 114.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.26 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |