C13H10N2O5 — CID 170189407
2-propoxypyrrolo[3,4-f]isoindole-1,3,5,7-tetrone (PubChem CID 170189407) has the molecular formula C13H10N2O5 and a molecular weight of 274.23 g/mol. Its IUPAC name is 2-propoxypyrrolo[3,4-f]isoindole-1,3,5,7-tetrone.
| Compound Name | 2-propoxypyrrolo[3,4-f]isoindole-1,3,5,7-tetrone |
|---|---|
| PubChem CID | 170189407 |
| Molecular Formula | C13H10N2O5 |
| Molecular Weight | 274.23 g/mol |
| Exact Mass | 274.06 |
| IUPAC Name | 2-propoxypyrrolo[3,4-f]isoindole-1,3,5,7-tetrone |
| SMILES | CCCOn1c(=O)c2cc3c(=O)[nH]c(=O)c3cc2c1=O |
| InChI | InChI=1S/C13H10N2O5/c1-2-3-20-15-12(18)8-4-6-7(5-9(8)13(15)19)11(17)14-10(6)16/h4-5H,2-3H2,1H3,(H,14,16,17) |
| InChIKey | DWRZPZDMNBFCBI-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 98.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.23 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |